Products 2386287-27-8
CAS 2386287-27-8 is the registry number for 5-Chloro-2-hydroxy-4-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-hydroxy-4-(trifluoromethyl)benzoic acid (CAS 2386287-27-8) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoic acid. InChIKey: NLHHVUFNWWXSBA-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | NLHHVUFNWWXSBA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)