CAS 433926-46-6 appears in our catalog under these names: 3–Chloro–5–(trifluoromethoxy)benzoic acid, 3-Chloro-5-(trifluoromethoxy)benzoic acid, 97%, 97%, 3-Chloro-5-(trifluoromethoxy)benzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 50g, 100g.
3-chloro-5-(trifluoromethoxy)benzoic acid (CAS 433926-46-6) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: KVXQRRFQLRUCKN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | KVXQRRFQLRUCKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)