Products 158580-93-9
CAS 158580-93-9 appears in our catalog under these names: 3-Chloro-4-(trifluoromethoxy)benzoic acid, 98%, 3–Chloro–4–(trifluoromethoxy)benzoic acid, 3-Chloro-4-(trifluoromethoxy)benzoic Acid, 97%, 97%, 3-Chloro-4-(trifluoromethoxy)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
3-chloro-4-(trifluoromethoxy)benzoic acid (CAS 158580-93-9) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 3-chloro-4-(trifluoromethoxy)benzoic acid. InChIKey: QGVQWEOEEXGRSD-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethoxy)benzoic acid |
| InChIKey | QGVQWEOEEXGRSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)