CAS 1261731-19-4 appears in our catalog under these names: 2-Chloro-4-(trifluoromethoxy)benzoic acid, 2-chloro-4-(trifluoromethoxy)benzoic acid, 95%, 2-Chloro-4-(trifluoromethoxy)benzoic acid, 97%. Offered by: Biosynth, Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 5g, 250mg, 10g.
2-chloro-4-(trifluoromethoxy)benzoic acid (CAS 1261731-19-4) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 2-chloro-4-(trifluoromethoxy)benzoic acid. InChIKey: PIEFBVAQKLROPX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethoxy)benzoic acid |
| InChIKey | PIEFBVAQKLROPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)