cas: 1368348-22-4 — see every product listed under this CAS number, including other names
2-CYCLOPENTYL-6-HYDROXYISONICOTINIC ACID, 97% (CAS 1368348-22-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533946-100MG |
| cas | 1368348-22-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 2044.09 Pln | |
| Fluorochem | 500mg | 3356.13 Pln | |
| Fluorochem | 1g | 5001.38 Pln | |
| Fluorochem | 5g | 14846.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid (CAS 1368348-22-4) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid. InChIKey: ZWGYOHPDCCVFIQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid |
| InChIKey | ZWGYOHPDCCVFIQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)