cas: 402-11-9 — see every product listed under this CAS number, including other names
2-Chloro-1-nitro-4-(trifluoromethyl)benzene 97% (CAS 402-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219205-1g |
| cas | 402-11-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 559.50 Pln | |
| Ambeed | 25g | 960.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A219205 |
2-chloro-1-nitro-4-(trifluoromethyl)benzene (CAS 402-11-9) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-1-nitro-4-(trifluoromethyl)benzene. InChIKey: CZWWSPDHNLAYRJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | CZWWSPDHNLAYRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)