cas: 1214386-29-4 — see every product listed under this CAS number, including other names
2-Chloro-4-bromo-5-fluorobenzaldehyde, 98%, 98% (CAS 1214386-29-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125ZG-500g |
| cas | 1214386-29-4 |
| size | 500g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 4185.60 Pln | |
| Chemat | 1kg | 7557.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 558.80 Pln | |
| Chemat | 50g | 957.20 Pln | |
| Chemat | 100g | 1715.60 Pln | |
| Chemat | 250g | 3851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-chloro-5-fluorobenzaldehyde (CAS 1214386-29-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-chloro-5-fluorobenzaldehyde. InChIKey: XPEGZWLIWARWAA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-fluorobenzaldehyde |
| InChIKey | XPEGZWLIWARWAA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Cl)C=O |
Computed by PubChem (NCBI)