2-Chloro-4-methylbenzene-1-sulfonyl chloride 95%
cas: 55311-94-9 — see every product listed under this CAS number, including other names
2-Chloro-4-methylbenzene-1-sulfonyl chloride 95% (CAS 55311-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A537181-100mg |
| cas | 55311-94-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1354.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A537181 |
2-chloro-4-methylbenzenesulfonyl chloride (CAS 55311-94-9) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 2-chloro-4-methylbenzenesulfonyl chloride. InChIKey: JWFLSLOCDIEDGQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2-chloro-4-methylbenzenesulfonyl chloride |
| InChIKey | JWFLSLOCDIEDGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-4-methylbenzene-1-sulfonyl chloride, 2-chloro-4-methylbenzenesulfonyl chloride, 2-chloro-4-methyl-benzenesulfonyl chloride, Benzenesulfonyl chloride, 2-chloro-4-methyl-, 2-Chlor-p-toluolsulfochlorid, JWFLSLOCDIEDGQ-UHFFFAOYSA-N, 3-chloro-4-toluenesulphonyl chloride, 2-Chloro-4-methylbenzene-1-sulfonylchloride