cas: 114997-91-0 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzo[d]oxazole 95% (CAS 114997-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A829046-100mg |
| cas | 114997-91-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 5154.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A829046 |
2-chloro-5-(trifluoromethyl)-1,3-benzoxazole (CAS 114997-91-0) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole. InChIKey: USIZXRJQPABFJF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | USIZXRJQPABFJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)Cl |
Computed by PubChem (NCBI)