cas: 114997-91-0 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzo[d]oxazole, 95%, 95% (CAS 114997-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FIY-100mg |
| cas | 114997-91-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 866.00 Pln | |
| Chemat | 5g | 3962.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-(trifluoromethyl)-1,3-benzoxazole (CAS 114997-91-0) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole. InChIKey: USIZXRJQPABFJF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | USIZXRJQPABFJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)Cl |
Computed by PubChem (NCBI)