cas: 237761-77-2 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzyl bromide (CAS 237761-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007840-1G |
| cas | 237761-77-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 25g | 1002.79 Pln |
| delivery time | 3-4 weeks |
|---|
2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene (CAS 237761-77-2) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene. InChIKey: BWOOBQYXRVOJSZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene |
| InChIKey | BWOOBQYXRVOJSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)Cl |
Computed by PubChem (NCBI)