CAS 1214339-27-1 is the registry number for 1-Bromo-4-(chloromethyl)-2-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.
1-bromo-4-(chloromethyl)-2-(trifluoromethyl)benzene (CAS 1214339-27-1) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 1-bromo-4-(chloromethyl)-2-(trifluoromethyl)benzene. InChIKey: MVQAOAPRDSGKGK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 1-bromo-4-(chloromethyl)-2-(trifluoromethyl)benzene |
| InChIKey | MVQAOAPRDSGKGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCl)C(F)(F)F)Br |
Computed by PubChem (NCBI)