CAS 279252-26-5 appears in our catalog under these names: 2-Chloro-4-(trifluoromethyl)benzyl bromide, 95%, 2-Chloro-4-(trifluoromethyl)benzyl bromide, 1-(Bromomethyl)-2-chloro-4-(trifluoromethyl)benzene 95%, 1-(Bromomethyl)-2-chloro-4-(trifluoromethyl)benzene, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene (CAS 279252-26-5) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene. InChIKey: AIZUUFYFLNVTQX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene |
| InChIKey | AIZUUFYFLNVTQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)CBr |
Computed by PubChem (NCBI)