CAS 1099597-30-4 is the registry number for 1-Bromo-4-chloro-2-(2,2,2-trifluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-4-chloro-2-(2,2,2-trifluoroethyl)benzene (CAS 1099597-30-4) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 1-bromo-4-chloro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: YRFOLKUXYFOHML-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 1-bromo-4-chloro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | YRFOLKUXYFOHML-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(F)(F)F)Br |
Computed by PubChem (NCBI)