CAS 237761-77-2 appears in our catalog under these names: 2-Chloro-5-(trifluoromethyl)benzyl bromide, 2-Chloro-5-(trifluoromethyl)benzyl bromide, 98%, 2–Chloro–5–5(trifluoromethyl)benzyl bromide, 2-(Bromomethyl)-1-chloro-4-(trifluoromethyl)benzene 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene (CAS 237761-77-2) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene. InChIKey: BWOOBQYXRVOJSZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-4-(trifluoromethyl)benzene |
| InChIKey | BWOOBQYXRVOJSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)Cl |
Computed by PubChem (NCBI)