CAS 886500-26-1 appears in our catalog under these names: 2–(Bromomethyl)–1–chloro–3–(trifluoromethyl)benzene, 2-Chloro-6-(trifluoromethyl)benzyl bromide, 95%, 2-Chloro-6-(trifluoromethyl)benzyl bromide, 97%, 2-(Bromomethyl)-1-chloro-3-(trifluoromethyl)benzene, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 250mg, 25g, 1g, 5g, 10g.
2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene (CAS 886500-26-1) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene. InChIKey: FSQANOAIVKWIEU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene |
| InChIKey | FSQANOAIVKWIEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CBr)C(F)(F)F |
Computed by PubChem (NCBI)