CAS 261763-23-9 appears in our catalog under these names: 4-Chloro-3-(trifluoromethyl)benzyl bromide, 95%, 4–Chloro–3–(trifluoromethyl)benzyl bromide, 4-(Bromomethyl)-1-chloro-2-(trifluoromethyl)benzene 98%, 4-Chloro-3-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg.
4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene (CAS 261763-23-9) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene. InChIKey: LZLIPLUATRVXSB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene |
| InChIKey | LZLIPLUATRVXSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)C(F)(F)F)Cl |
Computed by PubChem (NCBI)