cas: 54120-91-1 — see every product listed under this CAS number, including other names
2-Chloro-5-nitrobenzoxazole 96% (CAS 54120-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746255-100mg |
| cas | 54120-91-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2506.38 Pln | |
| Ambeed | 25g | 8597.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A746255 |
2-chloro-5-nitro-1,3-benzoxazole (CAS 54120-91-1) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 2-chloro-5-nitro-1,3-benzoxazole. InChIKey: JDESVZPWUYUPRC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 2-chloro-5-nitro-1,3-benzoxazole |
| InChIKey | JDESVZPWUYUPRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(O2)Cl |
Computed by PubChem (NCBI)