cas: 54120-91-1 — see every product listed under this CAS number, including other names
Benzoxazole, 2-chloro-5-nitro-, 98%, 98% (CAS 54120-91-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIWP-50mg |
| cas | 54120-91-1 |
| size | 50mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 1394.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-nitro-1,3-benzoxazole (CAS 54120-91-1) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 2-chloro-5-nitro-1,3-benzoxazole. InChIKey: JDESVZPWUYUPRC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 2-chloro-5-nitro-1,3-benzoxazole |
| InChIKey | JDESVZPWUYUPRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(O2)Cl |
Computed by PubChem (NCBI)