cas: 79455-63-3 — see every product listed under this CAS number, including other names
2-Chloro-6-fluorobenzene-1-carbonyl chloride, 97%, 97% (CAS 79455-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H1D-1g |
| cas | 79455-63-3 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1226.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-fluorobenzoyl chloride (CAS 79455-63-3) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-6-fluorobenzoyl chloride. InChIKey: GFNAJZAKJGKJCS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzoyl chloride |
| InChIKey | GFNAJZAKJGKJCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)