cas: 79455-63-3 — see every product listed under this CAS number, including other names
2-Chloro-6-fluorobenzoyl chloride, 97% (CAS 79455-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004439-1G |
| cas | 79455-63-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 25g | 560.24 Pln | |
| Fluorochem | 100g | 1794.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-6-fluorobenzoyl chloride (CAS 79455-63-3) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-6-fluorobenzoyl chloride. InChIKey: GFNAJZAKJGKJCS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzoyl chloride |
| InChIKey | GFNAJZAKJGKJCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)