CAS 312693-55-3 appears in our catalog under these names: (E)-3-(4-Chloro-2-fluorophenyl)acrylic acid, 98%, (E)-3-(4-Chloro-2-Fluorophenyl)Acrylic Acid, 98%, 98%, 4-Chloro-2-fluorocinnamic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoic acid (CAS 312693-55-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoic acid. InChIKey: FVLPOWWRHAOKMT-DUXPYHPUSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoic acid |
| InChIKey | FVLPOWWRHAOKMT-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)