CAS 261762-62-3 appears in our catalog under these names: 3–(3–Chloro–2–fluorophenyl)acrylic acid, 3-(3-Chloro-2-fluorophenyl)acrylic acid, 98%, 3-(3-Chloro-2-fluorophenyl)acrylic acid 95% (E), 3-(3-Chloro-2-Fluorophenyl)Acrylic Acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(E)-3-(3-chloro-2-fluorophenyl)prop-2-enoic acid (CAS 261762-62-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(3-chloro-2-fluorophenyl)prop-2-enoic acid. InChIKey: OJNDJHBNODEMSG-SNAWJCMRSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(3-chloro-2-fluorophenyl)prop-2-enoic acid |
| InChIKey | OJNDJHBNODEMSG-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)