cas: 5344-49-0 — see every product listed under this CAS number, including other names
2-Chloro-6-nitrobenzoic acid, 98%, 98% (CAS 5344-49-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 10g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H25-5g |
| cas | 5344-49-0 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 100g | 165.20 Pln | |
| Chemat | 500g | 556.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 1kg | 1024.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-nitrobenzoic acid (CAS 5344-49-0) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 2-chloro-6-nitrobenzoic acid. InChIKey: JYHOMEFOTKWQPN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 2-chloro-6-nitrobenzoic acid |
| InChIKey | JYHOMEFOTKWQPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)