cas: 15965-55-6 — see every product listed under this CAS number, including other names
2-Chloro-7-nitro-1H-benzo[d]imidazole 95% (CAS 15965-55-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A760644-5g |
| cas | 15965-55-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 4992.81 Pln | |
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1299.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A760644 |
2-chloro-4-nitro-1H-benzimidazole (CAS 15965-55-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 2-chloro-4-nitro-1H-benzimidazole. InChIKey: IDHWSFVCVDTHNI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 2-chloro-4-nitro-1H-benzimidazole |
| InChIKey | IDHWSFVCVDTHNI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])N=C(N2)Cl |
Computed by PubChem (NCBI)