cas: 34981-38-9 — see every product listed under this CAS number, including other names
2-Chlorosulfonyl-4-chlorotoluene, 98% (CAS 34981-38-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F871901-5G |
| cas | 34981-38-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 10g | 1669.22 Pln | |
| Fluorochem | 1g | 315.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2-methylbenzenesulfonyl chloride (CAS 34981-38-9) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 5-chloro-2-methylbenzenesulfonyl chloride. InChIKey: VHBFBNCERXCECQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 5-chloro-2-methylbenzenesulfonyl chloride |
| InChIKey | VHBFBNCERXCECQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)