cas: 208173-19-7 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)benzoyl chloride 98% (CAS 208173-19-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755801-10g |
| cas | 208173-19-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 570.62 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 375.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755801 |
2-fluoro-3-(trifluoromethyl)benzoyl chloride (CAS 208173-19-7) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzoyl chloride. InChIKey: RIKGRFSGIOOYEK-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | RIKGRFSGIOOYEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)