cas: 1092349-98-8 — see every product listed under this CAS number, including other names
2-Fluoro-3-methylbenzenesulfonyl chloride (CAS 1092349-98-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g, 10g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | STB34998-250mg |
| cas | 1092349-98-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 250mg | price on request | |
| Biosynth | 2,5g | price on request | |
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 1g | 2314.83 Pln | |
| Fluorochem | 5g | 7188.11 Pln | |
| Fluorochem | 10g | 11899.99 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
2-fluoro-3-methylbenzenesulfonyl chloride (CAS 1092349-98-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-fluoro-3-methylbenzenesulfonyl chloride. InChIKey: MQSQFPZVCHUKJH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-fluoro-3-methylbenzenesulfonyl chloride |
| InChIKey | MQSQFPZVCHUKJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)