CAS 1384429-15-5 appears in our catalog under these names: (2-Chlorophenyl)methanesulfonyl fluoride, 95%, (2-Chlorophenyl)methanesulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2-chlorophenyl)methanesulfonyl fluoride (CAS 1384429-15-5) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: (2-chlorophenyl)methanesulfonyl fluoride. InChIKey: AUDUPDRUYHEMHN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | (2-chlorophenyl)methanesulfonyl fluoride |
| InChIKey | AUDUPDRUYHEMHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)F)Cl |
Computed by PubChem (NCBI)