Products 518070-29-6
CAS 518070-29-6 appears in our catalog under these names: 2-Fluoro-4-methylbenzene-1-sulfonyl chloride 95%, 2-Fluoro-4-methylbenzenesulfonyl chloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
2-fluoro-4-methylbenzenesulfonyl chloride (CAS 518070-29-6) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-fluoro-4-methylbenzenesulfonyl chloride. InChIKey: SDBFDPOFXLVGQF-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-fluoro-4-methylbenzenesulfonyl chloride |
| InChIKey | SDBFDPOFXLVGQF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)
Synonyms:
2-fluoro-4-methylbenzenesulfonyl chloride, 2-fluoro-4-methylbenzenesulphonyl chloride, 2-fluoro-4-methylbenzene-1-sulfonyl chloride, 2-fluoro-4-methyl-benzenesulfonyl chloride, Benzenesulfonylchloride, 2-fluoro-4-methyl-, SDBFDPOFXLVGQF-UHFFFAOYSA-N, 2-fluoro-4-methyl benzenesulfonyl chlo, chloro(2-fluoro-4-methylphenyl)sulfone, 2-fluoro-4-methyl benzenesulfonyl chloride, 2-fluoro-4-methylbenzene-1-sulfonylchloride