cas: 957346-57-5 — see every product listed under this CAS number, including other names
2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98% (CAS 957346-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627074-250MG |
| cas | 957346-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2132.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 957346-57-5) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: AUQWDALPXJFOBB-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | AUQWDALPXJFOBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N)F |
Computed by PubChem (NCBI)