cas: 207981-46-2 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethyl)benzoyl chloride, 98%, 98% (CAS 207981-46-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JE6-1g |
| cas | 207981-46-2 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 25g | 558.80 Pln | |
| Chemat | 100g | 2046.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-5-(trifluoromethyl)benzoyl chloride (CAS 207981-46-2) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)benzoyl chloride. InChIKey: OFVKAIZITGCCDN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | OFVKAIZITGCCDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)F |
Computed by PubChem (NCBI)