CAS 220239-69-0 appears in our catalog under these names: 2–Fluoro–5–(trifluoromethyl)benzyl bromide, 2-Fluoro-5-(trifluoromethyl)benzyl bromide, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene (CAS 220239-69-0) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: BYRMZRWUEAESEZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | BYRMZRWUEAESEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)F |
Computed by PubChem (NCBI)