CAS 2167902-49-8 is the registry number for 2-Bromo-4-fluoro-3-methyl-1-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-bromo-1-fluoro-2-methyl-4-(trifluoromethyl)benzene (CAS 2167902-49-8) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 3-bromo-1-fluoro-2-methyl-4-(trifluoromethyl)benzene. InChIKey: WOIZWVUFJJGYLH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 3-bromo-1-fluoro-2-methyl-4-(trifluoromethyl)benzene |
| InChIKey | WOIZWVUFJJGYLH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)