Products 239135-48-9
CAS 239135-48-9 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethyl)benzyl bromide, 95%, 2-(Bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene, 98+%, 5-Fluoro-2-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene (CAS 239135-48-9) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene. InChIKey: MQZWBTRGSDOAIO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | MQZWBTRGSDOAIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)