CAS 92814-00-1 is the registry number for 4-Methyl-2,3,5,6-tetrafluorobenzyl bromide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-(bromomethyl)-2,3,5,6-tetrafluoro-4-methylbenzene (CAS 92814-00-1) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-methylbenzene. InChIKey: JGBVMYAEIPKDQB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-methylbenzene |
| InChIKey | JGBVMYAEIPKDQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)CBr)F)F |
Computed by PubChem (NCBI)