Products 213203-65-7
CAS 213203-65-7 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethyl)benzyl bromide, 98%, 4-(Bromomethyl)-2-fluoro-1-(trifluoromethyl)benzene 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
4-(bromomethyl)-2-fluoro-1-(trifluoromethyl)benzene (CAS 213203-65-7) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 4-(bromomethyl)-2-fluoro-1-(trifluoromethyl)benzene. InChIKey: MOVSRIIBGRAUAF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | MOVSRIIBGRAUAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)F)C(F)(F)F |
Computed by PubChem (NCBI)