CAS 261951-84-2 is the registry number for 3-Fluoro-2-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(bromomethyl)-3-fluoro-2-(trifluoromethyl)benzene (CAS 261951-84-2) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-3-fluoro-2-(trifluoromethyl)benzene. InChIKey: HTWOLWSZQAPKQA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-3-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | HTWOLWSZQAPKQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)