CAS 1186195-21-0 appears in our catalog under these names: 4-Bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene, 95%, 4-Bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene, 95+%, 4-Bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 2,5g, 250mg.
4-bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene (CAS 1186195-21-0) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 4-bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: BGLWAVHDOTYLCQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 4-bromo-1-fluoro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | BGLWAVHDOTYLCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(F)(F)F)F |
Computed by PubChem (NCBI)