cas: 195609-18-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrophenylacetic Acid, 98%, 98% (CAS 195609-18-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HAM-1g |
| cas | 195609-18-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 803.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-fluoro-5-nitrophenyl)acetic acid (CAS 195609-18-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)acetic acid. InChIKey: IDWINSICBKJFBK-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)acetic acid |
| InChIKey | IDWINSICBKJFBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC(=O)O)F |
Computed by PubChem (NCBI)