cas: 195609-18-8 — see every product listed under this CAS number, including other names
(2-Fluoro-5-nitro-phenyl)-acetic acid, 97% (CAS 195609-18-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032902-1G |
| cas | 195609-18-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 971.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-fluoro-5-nitrophenyl)acetic acid (CAS 195609-18-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)acetic acid. InChIKey: IDWINSICBKJFBK-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)acetic acid |
| InChIKey | IDWINSICBKJFBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC(=O)O)F |
Computed by PubChem (NCBI)