cas: 20174-70-3 — see every product listed under this CAS number, including other names
2-Hydrazinyl-6-methoxybenzo[d]thiazole 95% (CAS 20174-70-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294468-250mg |
| cas | 20174-70-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2350.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A294468 |
(6-methoxy-1,3-benzothiazol-2-yl)hydrazine (CAS 20174-70-3) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: (6-methoxy-1,3-benzothiazol-2-yl)hydrazine. InChIKey: QAMZBKMFWQSHDV-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (6-methoxy-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | QAMZBKMFWQSHDV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)NN |
Computed by PubChem (NCBI)