CAS 1071932-39-2 appears in our catalog under these names: 3-Phenyl-1,2,4-triazole-5-thiol hydrate, 95%, 5-Phenyl-1,2-dihydro-3H-1,2,4-triazole-3-thione hydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 100g, 5g.
5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione;hydrate (CAS 1071932-39-2) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione;hydrate. InChIKey: MLDZORJKIKBMKW-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione;hydrate |
| InChIKey | MLDZORJKIKBMKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=S)NN2.O |
Computed by PubChem (NCBI)