CAS 1173984-11-6 is the registry number for 5-Isothiocyanato-2-methoxy-4,6-dimethyl-pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-isothiocyanato-2-methoxy-4,6-dimethylpyrimidine (CAS 1173984-11-6) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: 5-isothiocyanato-2-methoxy-4,6-dimethylpyrimidine. InChIKey: GRVAGPSTCABKOI-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5-isothiocyanato-2-methoxy-4,6-dimethylpyrimidine |
| InChIKey | GRVAGPSTCABKOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)OC)C)N=C=S |
Computed by PubChem (NCBI)