CAS 568551-23-5 appears in our catalog under these names: 3-Amino-6-ethyl-3h-thieno[2,3-d]pyrimidin-4-one, 95%, 3-Amino-6-ethyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%, 3-Amino-6-ethyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-amino-6-ethylthieno[2,3-d]pyrimidin-4-one (CAS 568551-23-5) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: 3-amino-6-ethylthieno[2,3-d]pyrimidin-4-one. InChIKey: AXGOCFYTYBYMLZ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 3-amino-6-ethylthieno[2,3-d]pyrimidin-4-one |
| InChIKey | AXGOCFYTYBYMLZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)N=CN(C2=O)N |
Computed by PubChem (NCBI)