CAS 1192806-19-1 is the registry number for 2,3-Diamino-5-methoxyphenyl thiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2,3-diamino-5-methoxyphenyl) thiocyanate (CAS 1192806-19-1) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: (2,3-diamino-5-methoxyphenyl) thiocyanate. InChIKey: QORDBEUMBHJPQQ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (2,3-diamino-5-methoxyphenyl) thiocyanate |
| InChIKey | QORDBEUMBHJPQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)SC#N)N)N |
Computed by PubChem (NCBI)