Products 554420-45-0
CAS 554420-45-0 appears in our catalog under these names: 4-Methoxy-1,3-benzothiazole-2,7-diamine, 95%, 4-Methoxythieno(3,4-b)pyridine-5,7-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-methoxy-1,3-benzothiazole-2,7-diamine (CAS 554420-45-0) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: 4-methoxy-1,3-benzothiazole-2,7-diamine. InChIKey: BWRWTGMVDUJALO-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 4-methoxy-1,3-benzothiazole-2,7-diamine |
| InChIKey | BWRWTGMVDUJALO-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)N)SC(=N2)N |
Computed by PubChem (NCBI)