CAS 139359-96-9 is the registry number for 2,6-Dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(NE)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]hydroxylamine (CAS 139359-96-9) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: (NE)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]hydroxylamine. InChIKey: VDTQBBVNXNLCBZ-YCRREMRBSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (NE)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]hydroxylamine |
| InChIKey | VDTQBBVNXNLCBZ-YCRREMRBSA-N |
| SMILES | CC1=CN2C(=C(N=C2S1)C)/C=N/O |
Computed by PubChem (NCBI)