cas: 14562-10-8 — see every product listed under this CAS number, including other names
2-Hydroxy-[1,1'-biphenyl]-3-carbaldehyde, 95% (CAS 14562-10-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335236-250MG |
| cas | 14562-10-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1768.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-hydroxy-3-phenylbenzaldehyde (CAS 14562-10-8) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 2-hydroxy-3-phenylbenzaldehyde. InChIKey: IKYDTCFKUJZPPO-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-hydroxy-3-phenylbenzaldehyde |
| InChIKey | IKYDTCFKUJZPPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2O)C=O |
Computed by PubChem (NCBI)