CAS 400744-38-9 appears in our catalog under these names: 2-(4-Formylphenyl)phenol, 95%, 2'-Hydroxy-(1,1'-biphenyl)-4-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(2-hydroxyphenyl)benzaldehyde (CAS 400744-38-9) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 4-(2-hydroxyphenyl)benzaldehyde. InChIKey: JSBVZTOUPUKBJG-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 4-(2-hydroxyphenyl)benzaldehyde |
| InChIKey | JSBVZTOUPUKBJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C=O)O |
Computed by PubChem (NCBI)